C25H24Cl3N3O6 — CID 67440408
2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-1-[4-(2,4,6-trichlorobenzoyl)oxyphenyl]imidazol-1-ium-1-carboxylate (PubChem CID 67440408) has the molecular formula C25H24Cl3N3O6 and a molecular weight of 568.84 g/mol. Its IUPAC name is 2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-1-[4-(2,4,6-trichlorobenzoyl)oxyphenyl]imidazol-1-ium-1-carboxylate.
| Compound Name | 2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-1-[4-(2,4,6-trichlorobenzoyl)oxyphenyl]imidazol-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 67440408 |
| Molecular Formula | C25H24Cl3N3O6 |
| Molecular Weight | 568.84 g/mol |
| Exact Mass | 567.07 |
| IUPAC Name | 2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-1-[4-(2,4,6-trichlorobenzoyl)oxyphenyl]imidazol-1-ium-1-carboxylate |
| SMILES | CN(CCC1=NC=C[N+]1(C(=O)[O-])c1ccc(OC(=O)c2c(Cl)cc(Cl)cc2Cl)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H24Cl3N3O6/c1-25(2,3)37-23(33)30(4)11-9-20-29-10-12-31(20,24(34)35)16-5-7-17(8-6-16)36-22(32)21-18(27)13-15(26)14-19(21)28/h5-8,10,12-14H,9,11H2,1-4H3 |
| InChIKey | PXHXBEXGMKGWGM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.84 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|