C26H29N3O7 — CID 67439811
1-[4-(2-methoxybenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate (PubChem CID 67439811) has the molecular formula C26H29N3O7 and a molecular weight of 495.53 g/mol. Its IUPAC name is 1-[4-(2-methoxybenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate.
| Compound Name | 1-[4-(2-methoxybenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 67439811 |
| Molecular Formula | C26H29N3O7 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 1-[4-(2-methoxybenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate |
| SMILES | COc1ccccc1C(=O)Oc1ccc([N+]2(C(=O)[O-])C=CN=C2CCN(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H29N3O7/c1-26(2,3)36-24(31)28(4)16-14-22-27-15-17-29(22,25(32)33)18-10-12-19(13-11-18)35-23(30)20-8-6-7-9-21(20)34-5/h6-13,15,17H,14,16H2,1-5H3 |
| InChIKey | XMQHMZTVBGYMMH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 117.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|