C20H28N2O3 — CID 90267828
tert-butyl N-[2-(7-ethyl-8-methoxyquinolin-5-yl)ethyl]-N-methylcarbamate (PubChem CID 90267828) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is tert-butyl N-[2-(7-ethyl-8-methoxyquinolin-5-yl)ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(7-ethyl-8-methoxyquinolin-5-yl)ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 90267828 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | tert-butyl N-[2-(7-ethyl-8-methoxyquinolin-5-yl)ethyl]-N-methylcarbamate |
| SMILES | CCc1cc(CCN(C)C(=O)OC(C)(C)C)c2cccnc2c1OC |
| InChI | InChI=1S/C20H28N2O3/c1-7-14-13-15(10-12-22(5)19(23)25-20(2,3)4)16-9-8-11-21-17(16)18(14)24-6/h8-9,11,13H,7,10,12H2,1-6H3 |
| InChIKey | QDWPLIMXGSEDAO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |