C21H31N3O3 — CID 136622252
tert-butyl N-[3-[ethyl-(7-hydroxy-6-methylquinolin-8-yl)amino]propyl]-N-methylcarbamate (PubChem CID 136622252) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is tert-butyl N-[3-[ethyl-(7-hydroxy-6-methylquinolin-8-yl)amino]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[ethyl-(7-hydroxy-6-methylquinolin-8-yl)amino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 136622252 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | tert-butyl N-[3-[ethyl-(7-hydroxy-6-methylquinolin-8-yl)amino]propyl]-N-methylcarbamate |
| SMILES | CCN(CCCN(C)C(=O)OC(C)(C)C)c1c(O)c(C)cc2cccnc12 |
| InChI | InChI=1S/C21H31N3O3/c1-7-24(13-9-12-23(6)20(26)27-21(3,4)5)18-17-16(10-8-11-22-17)14-15(2)19(18)25/h8,10-11,14,25H,7,9,12-13H2,1-6H3 |
| InChIKey | IFYPSIBLYBXVDU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |