C15H23ClN2O2 — CID 163661402
tert-butyl N-[(4S)-4-chloro-4-pyridin-3-ylbutyl]-N-methylcarbamate (PubChem CID 163661402) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is tert-butyl N-[(4S)-4-chloro-4-pyridin-3-ylbutyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(4S)-4-chloro-4-pyridin-3-ylbutyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 163661402 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | tert-butyl N-[(4S)-4-chloro-4-pyridin-3-ylbutyl]-N-methylcarbamate |
| SMILES | CN(CCC[C@H](Cl)c1cccnc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23ClN2O2/c1-15(2,3)20-14(19)18(4)10-6-8-13(16)12-7-5-9-17-11-12/h5,7,9,11,13H,6,8,10H2,1-4H3/t13-/m0/s1 |
| InChIKey | IUSCNDXMUIGSQI-ZDUSSCGKSA-N |
| XLogP | 4.01 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|