C10H13Cl2N — CID 19894703
3-(1,5-dichloropentyl)pyridine (PubChem CID 19894703) has the molecular formula C10H13Cl2N and a molecular weight of 218.13 g/mol. Its IUPAC name is 3-(1,5-dichloropentyl)pyridine.
| Compound Name | 3-(1,5-dichloropentyl)pyridine |
|---|---|
| PubChem CID | 19894703 |
| Molecular Formula | C10H13Cl2N |
| Molecular Weight | 218.13 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 3-(1,5-dichloropentyl)pyridine |
| SMILES | ClCCCCC(Cl)c1cccnc1 |
| InChI | InChI=1S/C10H13Cl2N/c11-6-2-1-5-10(12)9-4-3-7-13-8-9/h3-4,7-8,10H,1-2,5-6H2 |
| InChIKey | FXMROTIKSUHNRR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.13 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|