C24H29N3O5 — CID 167163963
tert-butyl N-[2-[2-[[1-benzofuran-2-yl(pyridin-3-yl)methyl]amino]-2-oxoethoxy]ethyl]-N-methylcarbamate (PubChem CID 167163963) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[[1-benzofuran-2-yl(pyridin-3-yl)methyl]amino]-2-oxoethoxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[2-[[1-benzofuran-2-yl(pyridin-3-yl)methyl]amino]-2-oxoethoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 167163963 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | tert-butyl N-[2-[2-[[1-benzofuran-2-yl(pyridin-3-yl)methyl]amino]-2-oxoethoxy]ethyl]-N-methylcarbamate |
| SMILES | CN(CCOCC(=O)NC(c1cccnc1)c1cc2ccccc2o1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H29N3O5/c1-24(2,3)32-23(29)27(4)12-13-30-16-21(28)26-22(18-9-7-11-25-15-18)20-14-17-8-5-6-10-19(17)31-20/h5-11,14-15,22H,12-13,16H2,1-4H3,(H,26,28) |
| InChIKey | CGZKRHJVTXPMGI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|