C22H26N2O5S — CID 167164306
[7-[[1-benzofuran-2-yl(pyridin-3-yl)methyl]amino]-7-oxoheptyl] methanesulfonate (PubChem CID 167164306) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is [7-[[1-benzofuran-2-yl(pyridin-3-yl)methyl]amino]-7-oxoheptyl] methanesulfonate.
| Compound Name | [7-[[1-benzofuran-2-yl(pyridin-3-yl)methyl]amino]-7-oxoheptyl] methanesulfonate |
|---|---|
| PubChem CID | 167164306 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [7-[[1-benzofuran-2-yl(pyridin-3-yl)methyl]amino]-7-oxoheptyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCCCCCCC(=O)NC(c1cccnc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H26N2O5S/c1-30(26,27)28-14-7-3-2-4-12-21(25)24-22(18-10-8-13-23-16-18)20-15-17-9-5-6-11-19(17)29-20/h5-6,8-11,13,15-16,22H,2-4,7,12,14H2,1H3,(H,24,25) |
| InChIKey | RLOUJQWUZQVZII-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|