C18H23N3O3S — CID 131900152
N-[(3,4-dimethylphenyl)-pyridin-3-ylmethyl]-4-sulfamoylbutanamide (PubChem CID 131900152) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)-pyridin-3-ylmethyl]-4-sulfamoylbutanamide.
| Compound Name | N-[(3,4-dimethylphenyl)-pyridin-3-ylmethyl]-4-sulfamoylbutanamide |
|---|---|
| PubChem CID | 131900152 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[(3,4-dimethylphenyl)-pyridin-3-ylmethyl]-4-sulfamoylbutanamide |
| SMILES | Cc1ccc(C(NC(=O)CCCS(N)(=O)=O)c2cccnc2)cc1C |
| InChI | InChI=1S/C18H23N3O3S/c1-13-7-8-15(11-14(13)2)18(16-5-3-9-20-12-16)21-17(22)6-4-10-25(19,23)24/h3,5,7-9,11-12,18H,4,6,10H2,1-2H3,(H,21,22)(H2,19,23,24) |
| InChIKey | VKFNPJCLBUDFGL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |