C22H21ClN2O — CID 20897057
2-(4-chlorophenyl)-N-[(3,4-dimethylphenyl)-pyridin-3-ylmethyl]acetamide (PubChem CID 20897057) has the molecular formula C22H21ClN2O and a molecular weight of 364.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(3,4-dimethylphenyl)-pyridin-3-ylmethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(3,4-dimethylphenyl)-pyridin-3-ylmethyl]acetamide |
|---|---|
| PubChem CID | 20897057 |
| Molecular Formula | C22H21ClN2O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(3,4-dimethylphenyl)-pyridin-3-ylmethyl]acetamide |
| SMILES | Cc1ccc(C(NC(=O)Cc2ccc(Cl)cc2)c2cccnc2)cc1C |
| InChI | InChI=1S/C22H21ClN2O/c1-15-5-8-18(12-16(15)2)22(19-4-3-11-24-14-19)25-21(26)13-17-6-9-20(23)10-7-17/h3-12,14,22H,13H2,1-2H3,(H,25,26) |
| InChIKey | XGSGRIQIULMSTJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |