C21H19FN2O — CID 92500240
N-[(R)-(3,4-dimethylphenyl)-pyridin-3-ylmethyl]-2-fluorobenzamide (PubChem CID 92500240) has the molecular formula C21H19FN2O and a molecular weight of 334.39 g/mol. Its IUPAC name is N-[(R)-(3,4-dimethylphenyl)-pyridin-3-ylmethyl]-2-fluorobenzamide.
| Compound Name | N-[(R)-(3,4-dimethylphenyl)-pyridin-3-ylmethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 92500240 |
| Molecular Formula | C21H19FN2O |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[(R)-(3,4-dimethylphenyl)-pyridin-3-ylmethyl]-2-fluorobenzamide |
| SMILES | Cc1ccc([C@@H](NC(=O)c2ccccc2F)c2cccnc2)cc1C |
| InChI | InChI=1S/C21H19FN2O/c1-14-9-10-16(12-15(14)2)20(17-6-5-11-23-13-17)24-21(25)18-7-3-4-8-19(18)22/h3-13,20H,1-2H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | MDQBVIVVSLASDZ-HXUWFJFHSA-N |
| XLogP | 4.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |