C34H32N4O7 — CID 167164448
N-[1-benzofuran-2-yl(pyridin-3-yl)methyl]-5-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethoxy]pentanamide (PubChem CID 167164448) has the molecular formula C34H32N4O7 and a molecular weight of 608.65 g/mol. Its IUPAC name is N-[1-benzofuran-2-yl(pyridin-3-yl)methyl]-5-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethoxy]pentanamide.
| Compound Name | N-[1-benzofuran-2-yl(pyridin-3-yl)methyl]-5-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethoxy]pentanamide |
|---|---|
| PubChem CID | 167164448 |
| Molecular Formula | C34H32N4O7 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | N-[1-benzofuran-2-yl(pyridin-3-yl)methyl]-5-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethoxy]pentanamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CCOCCCCC(=O)NC(c4cccnc4)c4cc5ccccc5o4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C34H32N4O7/c39-28(36-31(23-9-6-16-35-20-23)27-19-22-7-1-2-11-26(22)45-27)12-3-4-17-44-18-15-21-8-5-10-24-30(21)34(43)38(33(24)42)25-13-14-29(40)37-32(25)41/h1-2,5-11,16,19-20,25,31H,3-4,12-15,17-18H2,(H,36,39)(H,37,40,41) |
| InChIKey | XUFUJZXPGISGBP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 147.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|