C40H43N7O7 — CID 164865658
7-[(butanoylamino)-pyridin-3-ylmethyl]-N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]heptyl]-8-hydroxyquinoline-5-carboxamide (PubChem CID 164865658) has the molecular formula C40H43N7O7 and a molecular weight of 733.83 g/mol. Its IUPAC name is 7-[(butanoylamino)-pyridin-3-ylmethyl]-N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]heptyl]-8-hydroxyquinoline-5-carboxamide.
| Compound Name | 7-[(butanoylamino)-pyridin-3-ylmethyl]-N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]heptyl]-8-hydroxyquinoline-5-carboxamide |
|---|---|
| PubChem CID | 164865658 |
| Molecular Formula | C40H43N7O7 |
| Molecular Weight | 733.83 g/mol |
| Exact Mass | 733.32 |
| IUPAC Name | 7-[(butanoylamino)-pyridin-3-ylmethyl]-N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]heptyl]-8-hydroxyquinoline-5-carboxamide |
| SMILES | CCCC(=O)NC(c1cccnc1)c1cc(C(=O)NCCCCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)c2cccnc2c1O |
| InChI | InChI=1S/C40H43N7O7/c1-2-11-31(48)45-34(24-12-9-18-41-23-24)28-22-27(25-14-10-21-43-35(25)36(28)50)37(51)44-20-7-5-3-4-6-19-42-29-15-8-13-26-33(29)40(54)47(39(26)53)30-16-17-32(49)46-38(30)52/h8-10,12-15,18,21-23,30,34,42,50H,2-7,11,16-17,19-20H2,1H3,(H,44,51)(H,45,48)(H,46,49,52) |
| InChIKey | PXEDVEPXOIWVNP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 199.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|