C24H23N7O4 — CID 167779754
2-(2,6-dioxopiperidin-3-yl)-4-[4-(pyrido[3,2-d]pyrimidin-4-ylamino)butylamino]isoindole-1,3-dione (PubChem CID 167779754) has the molecular formula C24H23N7O4 and a molecular weight of 473.49 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[4-(pyrido[3,2-d]pyrimidin-4-ylamino)butylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-(pyrido[3,2-d]pyrimidin-4-ylamino)butylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167779754 |
| Molecular Formula | C24H23N7O4 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-(pyrido[3,2-d]pyrimidin-4-ylamino)butylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCNc4ncnc5cccnc45)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H23N7O4/c32-18-9-8-17(22(33)30-18)31-23(34)14-5-3-6-15(19(14)24(31)35)25-10-1-2-11-27-21-20-16(28-13-29-21)7-4-12-26-20/h3-7,12-13,17,25H,1-2,8-11H2,(H,27,28,29)(H,30,32,33) |
| InChIKey | IBOXZEYPJVAMET-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|