C22H24N6O4 — CID 166426435
2-(2,6-dioxopiperidin-3-yl)-4-[4-[(2-methylpyrimidin-4-yl)amino]butylamino]isoindole-1,3-dione (PubChem CID 166426435) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[4-[(2-methylpyrimidin-4-yl)amino]butylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[(2-methylpyrimidin-4-yl)amino]butylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166426435 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[(2-methylpyrimidin-4-yl)amino]butylamino]isoindole-1,3-dione |
| SMILES | Cc1nccc(NCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)n1 |
| InChI | InChI=1S/C22H24N6O4/c1-13-23-12-9-17(26-13)25-11-3-2-10-24-15-6-4-5-14-19(15)22(32)28(21(14)31)16-7-8-18(29)27-20(16)30/h4-6,9,12,16,24H,2-3,7-8,10-11H2,1H3,(H,23,25,26)(H,27,29,30) |
| InChIKey | VBGHLNWURQRQHP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|