C23H28N6O4S — CID 166426424
4-[4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]butylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 166426424) has the molecular formula C23H28N6O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is 4-[4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]butylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]butylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166426424 |
| Molecular Formula | C23H28N6O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 4-[4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]butylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC(C)(C)c1nsc(NCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)n1 |
| InChI | InChI=1S/C23H28N6O4S/c1-23(2,3)21-27-22(34-28-21)25-12-5-4-11-24-14-8-6-7-13-17(14)20(33)29(19(13)32)15-9-10-16(30)26-18(15)31/h6-8,15,24H,4-5,9-12H2,1-3H3,(H,25,27,28)(H,26,30,31) |
| InChIKey | PMZKNPGMACDQLO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|