C25H25N5O4S — CID 166426431
2-(2,6-dioxopiperidin-3-yl)-4-[4-[(5-methyl-1,3-benzothiazol-2-yl)amino]butylamino]isoindole-1,3-dione (PubChem CID 166426431) has the molecular formula C25H25N5O4S and a molecular weight of 491.57 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[4-[(5-methyl-1,3-benzothiazol-2-yl)amino]butylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[(5-methyl-1,3-benzothiazol-2-yl)amino]butylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166426431 |
| Molecular Formula | C25H25N5O4S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[(5-methyl-1,3-benzothiazol-2-yl)amino]butylamino]isoindole-1,3-dione |
| SMILES | Cc1ccc2sc(NCCCCNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)nc2c1 |
| InChI | InChI=1S/C25H25N5O4S/c1-14-7-9-19-17(13-14)28-25(35-19)27-12-3-2-11-26-16-6-4-5-15-21(16)24(34)30(23(15)33)18-8-10-20(31)29-22(18)32/h4-7,9,13,18,26H,2-3,8,10-12H2,1H3,(H,27,28)(H,29,31,32) |
| InChIKey | UJOLNLKDHKDUFW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|