C39H41N5O6 — CID 175670543
N-[[3-(dimethylamino)phenyl]-(8-hydroxy-5-methylquinolin-7-yl)methyl]-6-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]amino]hexanamide (PubChem CID 175670543) has the molecular formula C39H41N5O6 and a molecular weight of 675.79 g/mol. Its IUPAC name is N-[[3-(dimethylamino)phenyl]-(8-hydroxy-5-methylquinolin-7-yl)methyl]-6-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]amino]hexanamide.
| Compound Name | N-[[3-(dimethylamino)phenyl]-(8-hydroxy-5-methylquinolin-7-yl)methyl]-6-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]amino]hexanamide |
|---|---|
| PubChem CID | 175670543 |
| Molecular Formula | C39H41N5O6 |
| Molecular Weight | 675.79 g/mol |
| Exact Mass | 675.31 |
| IUPAC Name | N-[[3-(dimethylamino)phenyl]-(8-hydroxy-5-methylquinolin-7-yl)methyl]-6-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]amino]hexanamide |
| SMILES | Cc1cc(C(NC(=O)CCCCCNc2cccc3c2C(=O)N(C2CCC(=O)CC2=O)C3=O)c2cccc(N(C)C)c2)c(O)c2ncccc12 |
| InChI | InChI=1S/C39H41N5O6/c1-23-20-29(37(48)36-27(23)13-9-19-41-36)35(24-10-7-11-25(21-24)43(2)3)42-33(47)15-5-4-6-18-40-30-14-8-12-28-34(30)39(50)44(38(28)49)31-17-16-26(45)22-32(31)46/h7-14,19-21,31,35,40,48H,4-6,15-18,22H2,1-3H3,(H,42,47) |
| InChIKey | MTGWDSYRFCDNJN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 149.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.79 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|