C34H44N4O5 — CID 167088482
11-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-N-[(3,4,5-trimethylphenyl)methyl]undecanamide (PubChem CID 167088482) has the molecular formula C34H44N4O5 and a molecular weight of 588.75 g/mol. Its IUPAC name is 11-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-N-[(3,4,5-trimethylphenyl)methyl]undecanamide.
| Compound Name | 11-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-N-[(3,4,5-trimethylphenyl)methyl]undecanamide |
|---|---|
| PubChem CID | 167088482 |
| Molecular Formula | C34H44N4O5 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | 11-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-N-[(3,4,5-trimethylphenyl)methyl]undecanamide |
| SMILES | Cc1cc(CNC(=O)CCCCCCCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc(C)c1C |
| InChI | InChI=1S/C34H44N4O5/c1-22-19-25(20-23(2)24(22)3)21-36-29(39)15-10-8-6-4-5-7-9-11-18-35-27-14-12-13-26-31(27)34(43)38(33(26)42)28-16-17-30(40)37-32(28)41/h12-14,19-20,28,35H,4-11,15-18,21H2,1-3H3,(H,36,39)(H,37,40,41) |
| InChIKey | NZVQZMTVENLMAE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|