C41H45N7O7 — CID 168740565
N-[[4-[2-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methyl]-9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]nonanamide (PubChem CID 168740565) has the molecular formula C41H45N7O7 and a molecular weight of 747.85 g/mol. Its IUPAC name is N-[[4-[2-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methyl]-9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]nonanamide.
| Compound Name | N-[[4-[2-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methyl]-9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]nonanamide |
|---|---|
| PubChem CID | 168740565 |
| Molecular Formula | C41H45N7O7 |
| Molecular Weight | 747.85 g/mol |
| Exact Mass | 747.34 |
| IUPAC Name | N-[[4-[2-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methyl]-9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]nonanamide |
| SMILES | Nc1nnc(-c2ccccc2O)cc1OCCc1ccc(CNC(=O)CCCCCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C41H45N7O7/c42-38-34(24-31(46-47-38)28-10-6-7-13-33(28)49)55-23-21-26-15-17-27(18-16-26)25-44-35(50)14-5-3-1-2-4-8-22-43-30-12-9-11-29-37(30)41(54)48(40(29)53)32-19-20-36(51)45-39(32)52/h6-7,9-13,15-18,24,32,43,49H,1-5,8,14,19-23,25H2,(H2,42,47)(H,44,50)(H,45,51,52) |
| InChIKey | UPYNZZXPFMATQQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 205.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|