C37H37FN6O7 — CID 168740589
4-[5-[[4-[2-[3-amino-6-(5-fluoro-2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methylamino]pentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 168740589) has the molecular formula C37H37FN6O7 and a molecular weight of 696.74 g/mol. Its IUPAC name is 4-[5-[[4-[2-[3-amino-6-(5-fluoro-2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methylamino]pentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[5-[[4-[2-[3-amino-6-(5-fluoro-2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methylamino]pentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168740589 |
| Molecular Formula | C37H37FN6O7 |
| Molecular Weight | 696.74 g/mol |
| Exact Mass | 696.27 |
| IUPAC Name | 4-[5-[[4-[2-[3-amino-6-(5-fluoro-2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methylamino]pentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Nc1nnc(-c2cc(F)ccc2O)cc1OCCc1ccc(CNCCCCCOc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C37H37FN6O7/c38-24-11-13-29(45)26(19-24)27-20-31(34(39)43-42-27)51-18-15-22-7-9-23(10-8-22)21-40-16-2-1-3-17-50-30-6-4-5-25-33(30)37(49)44(36(25)48)28-12-14-32(46)41-35(28)47/h4-11,13,19-20,28,40,45H,1-3,12,14-18,21H2,(H2,39,43)(H,41,46,47) |
| InChIKey | SMGJXRLBHMOXJK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 186.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|