C20H16N2O7 — CID 71066885
4-[(3,4-dihydroxyphenyl)methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 71066885) has the molecular formula C20H16N2O7 and a molecular weight of 396.36 g/mol. Its IUPAC name is 4-[(3,4-dihydroxyphenyl)methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[(3,4-dihydroxyphenyl)methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 71066885 |
| Molecular Formula | C20H16N2O7 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 4-[(3,4-dihydroxyphenyl)methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(OCc4ccc(O)c(O)c4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H16N2O7/c23-13-6-4-10(8-14(13)24)9-29-15-3-1-2-11-17(15)20(28)22(19(11)27)12-5-7-16(25)21-18(12)26/h1-4,6,8,12,23-24H,5,7,9H2,(H,21,25,26) |
| InChIKey | IFYMURWDALHTPV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|