C23H17N3O5 — CID 124563279
2-[(3S)-2,6-dioxopiperidin-3-yl]-4-(quinolin-3-ylmethoxy)isoindole-1,3-dione (PubChem CID 124563279) has the molecular formula C23H17N3O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-(quinolin-3-ylmethoxy)isoindole-1,3-dione.
| Compound Name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-(quinolin-3-ylmethoxy)isoindole-1,3-dione |
|---|---|
| PubChem CID | 124563279 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-(quinolin-3-ylmethoxy)isoindole-1,3-dione |
| SMILES | O=C1CC[C@H](N2C(=O)c3cccc(OCc4cnc5ccccc5c4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H17N3O5/c27-19-9-8-17(21(28)25-19)26-22(29)15-5-3-7-18(20(15)23(26)30)31-12-13-10-14-4-1-2-6-16(14)24-11-13/h1-7,10-11,17H,8-9,12H2,(H,25,27,28)/t17-/m0/s1 |
| InChIKey | YJYAGEUHHBFPBQ-KRWDZBQOSA-N |
| XLogP | 2.21 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|