C26H20N4O5 — CID 138557040
2-(2,6-dioxopiperidin-3-yl)-4-[[4-[(4-ethynylpyrazol-1-yl)methyl]phenyl]methoxy]isoindole-1,3-dione (PubChem CID 138557040) has the molecular formula C26H20N4O5 and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[4-[(4-ethynylpyrazol-1-yl)methyl]phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[4-[(4-ethynylpyrazol-1-yl)methyl]phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 138557040 |
| Molecular Formula | C26H20N4O5 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[4-[(4-ethynylpyrazol-1-yl)methyl]phenyl]methoxy]isoindole-1,3-dione |
| SMILES | C#Cc1cnn(Cc2ccc(COc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)cc2)c1 |
| InChI | InChI=1S/C26H20N4O5/c1-2-16-12-27-29(13-16)14-17-6-8-18(9-7-17)15-35-21-5-3-4-19-23(21)26(34)30(25(19)33)20-10-11-22(31)28-24(20)32/h1,3-9,12-13,20H,10-11,14-15H2,(H,28,31,32) |
| InChIKey | MBCOSSMIUFJQNP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|