C27H25F3N6O5 — CID 67334112
2-(2,6-dioxopiperidin-3-yl)-4-[[4-[[2-(trifluoromethyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione (PubChem CID 67334112) has the molecular formula C27H25F3N6O5 and a molecular weight of 570.53 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[4-[[2-(trifluoromethyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[4-[[2-(trifluoromethyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67334112 |
| Molecular Formula | C27H25F3N6O5 |
| Molecular Weight | 570.53 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[4-[[2-(trifluoromethyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(OCc4ccc(CN5CCN6NC(C(F)(F)F)=NC6C5)cc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H25F3N6O5/c28-27(29,30)26-31-20-13-34(10-11-35(20)33-26)12-15-4-6-16(7-5-15)14-41-19-3-1-2-17-22(19)25(40)36(24(17)39)18-8-9-21(37)32-23(18)38/h1-7,18,20H,8-14H2,(H,31,33)(H,32,37,38) |
| InChIKey | JMICELSMCVNLON-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|