C32H27F3N4O6 — CID 175656764
2-(2,6-dioxopiperidin-3-yl)-4-[4-[[4-[2-(trifluoromethoxy)benzoyl]piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione (PubChem CID 175656764) has the molecular formula C32H27F3N4O6 and a molecular weight of 620.58 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[4-[[4-[2-(trifluoromethoxy)benzoyl]piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[[4-[2-(trifluoromethoxy)benzoyl]piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175656764 |
| Molecular Formula | C32H27F3N4O6 |
| Molecular Weight | 620.58 g/mol |
| Exact Mass | 620.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[[4-[2-(trifluoromethoxy)benzoyl]piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(-c4ccc(CN5CCN(C(=O)c6ccccc6OC(F)(F)F)CC5)cc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H27F3N4O6/c33-32(34,35)45-25-7-2-1-4-22(25)29(42)38-16-14-37(15-17-38)18-19-8-10-20(11-9-19)21-5-3-6-23-27(21)31(44)39(30(23)43)24-12-13-26(40)36-28(24)41/h1-11,24H,12-18H2,(H,36,40,41) |
| InChIKey | MHGIAQYJQXGRSN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|