C25H29F3N4O6 — CID 175654650
2-(2,6-dioxopiperidin-3-yl)-4-[3-[4-(4,4,4-trifluorobutanoyl)-1,4-diazepan-1-yl]propoxy]isoindole-1,3-dione (PubChem CID 175654650) has the molecular formula C25H29F3N4O6 and a molecular weight of 538.52 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[3-[4-(4,4,4-trifluorobutanoyl)-1,4-diazepan-1-yl]propoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-[4-(4,4,4-trifluorobutanoyl)-1,4-diazepan-1-yl]propoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175654650 |
| Molecular Formula | C25H29F3N4O6 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-[4-(4,4,4-trifluorobutanoyl)-1,4-diazepan-1-yl]propoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(OCCCN4CCCN(C(=O)CCC(F)(F)F)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H29F3N4O6/c26-25(27,28)9-8-20(34)31-12-2-10-30(13-14-31)11-3-15-38-18-5-1-4-16-21(18)24(37)32(23(16)36)17-6-7-19(33)29-22(17)35/h1,4-5,17H,2-3,6-15H2,(H,29,33,35) |
| InChIKey | RAEXFQQXDFUVJV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|