C30H35N5O4 — CID 175660175
2-(2,6-dioxopiperidin-3-yl)-4-[4-[[4-(piperazin-1-ylmethyl)piperidin-1-yl]methyl]phenyl]isoindole-1,3-dione (PubChem CID 175660175) has the molecular formula C30H35N5O4 and a molecular weight of 529.64 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[4-[[4-(piperazin-1-ylmethyl)piperidin-1-yl]methyl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[[4-(piperazin-1-ylmethyl)piperidin-1-yl]methyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175660175 |
| Molecular Formula | C30H35N5O4 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[[4-(piperazin-1-ylmethyl)piperidin-1-yl]methyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(-c4ccc(CN5CCC(CN6CCNCC6)CC5)cc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H35N5O4/c36-26-9-8-25(28(37)32-26)35-29(38)24-3-1-2-23(27(24)30(35)39)22-6-4-20(5-7-22)18-33-14-10-21(11-15-33)19-34-16-12-31-13-17-34/h1-7,21,25,31H,8-19H2,(H,32,36,37) |
| InChIKey | KADZIQNJASKYEX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|