C30H34N4O4 — CID 175660278
2-(2,6-dioxopiperidin-3-yl)-5-[3-[(4-piperidin-4-ylpiperidin-1-yl)methyl]phenyl]isoindole-1,3-dione (PubChem CID 175660278) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[(4-piperidin-4-ylpiperidin-1-yl)methyl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[(4-piperidin-4-ylpiperidin-1-yl)methyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175660278 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[(4-piperidin-4-ylpiperidin-1-yl)methyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(-c4cccc(CN5CCC(C6CCNCC6)CC5)c4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H34N4O4/c35-27-7-6-26(28(36)32-27)34-29(37)24-5-4-23(17-25(24)30(34)38)22-3-1-2-19(16-22)18-33-14-10-21(11-15-33)20-8-12-31-13-9-20/h1-5,16-17,20-21,26,31H,6-15,18H2,(H,32,35,36) |
| InChIKey | KCBUZNMZWPSRCT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|