C30H34N4O5 — CID 175655015
2-(2,6-dioxopiperidin-3-yl)-5-[3-[[4-(2-ethylbutanoyl)piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione (PubChem CID 175655015) has the molecular formula C30H34N4O5 and a molecular weight of 530.63 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[[4-(2-ethylbutanoyl)piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[[4-(2-ethylbutanoyl)piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175655015 |
| Molecular Formula | C30H34N4O5 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[[4-(2-ethylbutanoyl)piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione |
| SMILES | CCC(CC)C(=O)N1CCN(Cc2cccc(-c3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)c2)CC1 |
| InChI | InChI=1S/C30H34N4O5/c1-3-20(4-2)28(37)33-14-12-32(13-15-33)18-19-6-5-7-21(16-19)22-8-9-23-24(17-22)30(39)34(29(23)38)25-10-11-26(35)31-27(25)36/h5-9,16-17,20,25H,3-4,10-15,18H2,1-2H3,(H,31,35,36) |
| InChIKey | PVSPHZMZDSFPTN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|