C31H27FN4O5 — CID 175656034
2-(2,6-dioxopiperidin-3-yl)-4-[3-[[4-(2-fluorobenzoyl)piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione (PubChem CID 175656034) has the molecular formula C31H27FN4O5 and a molecular weight of 554.58 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[3-[[4-(2-fluorobenzoyl)piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-[[4-(2-fluorobenzoyl)piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175656034 |
| Molecular Formula | C31H27FN4O5 |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-[[4-(2-fluorobenzoyl)piperazin-1-yl]methyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(-c4cccc(CN5CCN(C(=O)c6ccccc6F)CC5)c4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H27FN4O5/c32-24-10-2-1-7-22(24)29(39)35-15-13-34(14-16-35)18-19-5-3-6-20(17-19)21-8-4-9-23-27(21)31(41)36(30(23)40)25-11-12-26(37)33-28(25)38/h1-10,17,25H,11-16,18H2,(H,33,37,38) |
| InChIKey | FJLJVECXSYFKAF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|