C26H22FN3O5 — CID 175654914
2-(2,6-dioxopiperidin-3-yl)-4-[1-[2-(2-fluorophenyl)acetyl]-3,6-dihydro-2H-pyridin-4-yl]isoindole-1,3-dione (PubChem CID 175654914) has the molecular formula C26H22FN3O5 and a molecular weight of 475.48 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[1-[2-(2-fluorophenyl)acetyl]-3,6-dihydro-2H-pyridin-4-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[1-[2-(2-fluorophenyl)acetyl]-3,6-dihydro-2H-pyridin-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175654914 |
| Molecular Formula | C26H22FN3O5 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[1-[2-(2-fluorophenyl)acetyl]-3,6-dihydro-2H-pyridin-4-yl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(C4=CCN(C(=O)Cc5ccccc5F)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H22FN3O5/c27-19-7-2-1-4-16(19)14-22(32)29-12-10-15(11-13-29)17-5-3-6-18-23(17)26(35)30(25(18)34)20-8-9-21(31)28-24(20)33/h1-7,10,20H,8-9,11-14H2,(H,28,31,33) |
| InChIKey | MMQZICDCIQNJFZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|