C33H35F3N4O5 — CID 175655329
2-(2,6-dioxopiperidin-3-yl)-4-[4-[[3-(4,4,4-trifluorobutanoyl)-3,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]isoindole-1,3-dione (PubChem CID 175655329) has the molecular formula C33H35F3N4O5 and a molecular weight of 624.66 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[4-[[3-(4,4,4-trifluorobutanoyl)-3,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[[3-(4,4,4-trifluorobutanoyl)-3,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175655329 |
| Molecular Formula | C33H35F3N4O5 |
| Molecular Weight | 624.66 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[[3-(4,4,4-trifluorobutanoyl)-3,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(-c4ccc(CN5CCC6(CC5)CCN(C(=O)CCC(F)(F)F)CC6)cc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H35F3N4O5/c34-33(35,36)11-10-27(42)39-18-14-32(15-19-39)12-16-38(17-13-32)20-21-4-6-22(7-5-21)23-2-1-3-24-28(23)31(45)40(30(24)44)25-8-9-26(41)37-29(25)43/h1-7,25H,8-20H2,(H,37,41,43) |
| InChIKey | RMMWUUVSOHYIJJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.66 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|