C30H29F2N5O5 — CID 123860449
4-[[4-[[2-(1,1-difluoropropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]phenyl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 123860449) has the molecular formula C30H29F2N5O5 and a molecular weight of 577.59 g/mol. Its IUPAC name is 4-[[4-[[2-(1,1-difluoropropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]phenyl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[4-[[2-(1,1-difluoropropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]phenyl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 123860449 |
| Molecular Formula | C30H29F2N5O5 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 4-[[4-[[2-(1,1-difluoropropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]phenyl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCC(F)(F)c1cn2c(n1)CN(Cc1ccc(COc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)cc1)CC2 |
| InChI | InChI=1S/C30H29F2N5O5/c1-2-30(31,32)23-15-36-13-12-35(16-24(36)33-23)14-18-6-8-19(9-7-18)17-42-22-5-3-4-20-26(22)29(41)37(28(20)40)21-10-11-25(38)34-27(21)39/h3-9,15,21H,2,10-14,16-17H2,1H3,(H,34,38,39) |
| InChIKey | OHPFRQNGZRFRNE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|