C38H45N7O7 — CID 153358715
4-[11-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]-11-oxoundecoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 153358715) has the molecular formula C38H45N7O7 and a molecular weight of 711.82 g/mol. Its IUPAC name is 4-[11-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]-11-oxoundecoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[11-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]-11-oxoundecoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 153358715 |
| Molecular Formula | C38H45N7O7 |
| Molecular Weight | 711.82 g/mol |
| Exact Mass | 711.34 |
| IUPAC Name | 4-[11-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]-11-oxoundecoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Nc1nnc(-c2ccccc2O)cc1N1CCN(C(=O)CCCCCCCCCCOc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C38H45N7O7/c39-35-29(24-27(41-42-35)25-12-8-9-14-30(25)46)43-19-21-44(22-20-43)33(48)16-7-5-3-1-2-4-6-10-23-52-31-15-11-13-26-34(31)38(51)45(37(26)50)28-17-18-32(47)40-36(28)49/h8-9,11-15,24,28,46H,1-7,10,16-23H2,(H2,39,42)(H,40,47,49) |
| InChIKey | WALJYHLIDMMGGP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 188.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.82 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|