C35H44N6O7 — CID 155400514
4-[6-[4-[1-(4-amino-3-methoxyphenyl)piperidin-4-yl]piperazin-1-yl]-6-oxohexoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 155400514) has the molecular formula C35H44N6O7 and a molecular weight of 660.77 g/mol. Its IUPAC name is 4-[6-[4-[1-(4-amino-3-methoxyphenyl)piperidin-4-yl]piperazin-1-yl]-6-oxohexoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[6-[4-[1-(4-amino-3-methoxyphenyl)piperidin-4-yl]piperazin-1-yl]-6-oxohexoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 155400514 |
| Molecular Formula | C35H44N6O7 |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 660.33 |
| IUPAC Name | 4-[6-[4-[1-(4-amino-3-methoxyphenyl)piperidin-4-yl]piperazin-1-yl]-6-oxohexoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | COc1cc(N2CCC(N3CCN(C(=O)CCCCCOc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)ccc1N |
| InChI | InChI=1S/C35H44N6O7/c1-47-29-22-24(9-10-26(29)36)38-15-13-23(14-16-38)39-17-19-40(20-18-39)31(43)8-3-2-4-21-48-28-7-5-6-25-32(28)35(46)41(34(25)45)27-11-12-30(42)37-33(27)44/h5-7,9-10,22-23,27H,2-4,8,11-21,36H2,1H3,(H,37,42,44) |
| InChIKey | ASQQWAHRCJNYQS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 154.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|