C21H23N3O8 — CID 166007679
3-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoylamino]propanoic acid (PubChem CID 166007679) has the molecular formula C21H23N3O8 and a molecular weight of 445.43 g/mol. Its IUPAC name is 3-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoylamino]propanoic acid.
| Compound Name | 3-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoylamino]propanoic acid |
|---|---|
| PubChem CID | 166007679 |
| Molecular Formula | C21H23N3O8 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)CCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H23N3O8/c25-15(22-10-9-17(27)28)6-1-2-11-32-14-5-3-4-12-18(14)21(31)24(20(12)30)13-7-8-16(26)23-19(13)29/h3-5,13H,1-2,6-11H2,(H,22,25)(H,27,28)(H,23,26,29) |
| InChIKey | SZNHMLOXLNORNX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|