C37H39FN4O13 — CID 167639947
deuterio(fluoro)methane;5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanal;5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoic acid (PubChem CID 167639947) has the molecular formula C37H39FN4O13 and a molecular weight of 767.74 g/mol. Its IUPAC name is deuterio(fluoro)methane;5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanal;5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoic acid.
| Compound Name | deuterio(fluoro)methane;5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanal;5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 167639947 |
| Molecular Formula | C37H39FN4O13 |
| Molecular Weight | 767.74 g/mol |
| Exact Mass | 767.26 |
| IUPAC Name | deuterio(fluoro)methane;5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanal;5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoic acid |
| SMILES | O=C(O)CCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.O=CCCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.[2H]CF |
| InChI | InChI=1S/C18H18N2O7.C18H18N2O6.CH3F/c21-13-8-7-11(16(24)19-13)20-17(25)10-4-3-5-12(15(10)18(20)26)27-9-2-1-6-14(22)23;21-9-2-1-3-10-26-13-6-4-5-11-15(13)18(25)20(17(11)24)12-7-8-14(22)19-16(12)23;1-2/h3-5,11H,1-2,6-9H2,(H,22,23)(H,19,21,24);4-6,9,12H,1-3,7-8,10H2,(H,19,22,23);1H3/i;;1D |
| InChIKey | PAKISXBBTWEDNS-PRQZKWGPSA-N |
| XLogP | 2.14 |
| TPSA | 239.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.74 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|