C39H43FN4O13 — CID 167550970
deuterio(fluoro)methane;6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexanal;6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexanoic acid (PubChem CID 167550970) has the molecular formula C39H43FN4O13 and a molecular weight of 795.79 g/mol. Its IUPAC name is deuterio(fluoro)methane;6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexanal;6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexanoic acid.
| Compound Name | deuterio(fluoro)methane;6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexanal;6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 167550970 |
| Molecular Formula | C39H43FN4O13 |
| Molecular Weight | 795.79 g/mol |
| Exact Mass | 795.29 |
| IUPAC Name | deuterio(fluoro)methane;6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexanal;6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.O=CCCCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.[2H]CF |
| InChI | InChI=1S/C19H20N2O7.C19H20N2O6.CH3F/c22-14-9-8-12(17(25)20-14)21-18(26)11-5-4-6-13(16(11)19(21)27)28-10-3-1-2-7-15(23)24;22-10-3-1-2-4-11-27-14-7-5-6-12-16(14)19(26)21(18(12)25)13-8-9-15(23)20-17(13)24;1-2/h4-6,12H,1-3,7-10H2,(H,23,24)(H,20,22,25);5-7,10,13H,1-4,8-9,11H2,(H,20,23,24);1H3/i;;1D |
| InChIKey | CJXGJPWRQJAGNA-PRQZKWGPSA-N |
| XLogP | 2.92 |
| TPSA | 239.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|