C25H31N3O8 — CID 166007652
tert-butyl 3-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoylamino]propanoate (PubChem CID 166007652) has the molecular formula C25H31N3O8 and a molecular weight of 501.54 g/mol. Its IUPAC name is tert-butyl 3-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoylamino]propanoate.
| Compound Name | tert-butyl 3-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoylamino]propanoate |
|---|---|
| PubChem CID | 166007652 |
| Molecular Formula | C25H31N3O8 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | tert-butyl 3-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypentanoylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNC(=O)CCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H31N3O8/c1-25(2,3)36-20(31)12-13-26-18(29)9-4-5-14-35-17-8-6-7-15-21(17)24(34)28(23(15)33)16-10-11-19(30)27-22(16)32/h6-8,16H,4-5,9-14H2,1-3H3,(H,26,29)(H,27,30,32) |
| InChIKey | UFNYNIRVIPOIAX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|