C38H38N6O7 — CID 168740556
4-[3-[1-[[4-[2-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methyl]azetidin-3-yl]propoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 168740556) has the molecular formula C38H38N6O7 and a molecular weight of 690.76 g/mol. Its IUPAC name is 4-[3-[1-[[4-[2-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methyl]azetidin-3-yl]propoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[3-[1-[[4-[2-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methyl]azetidin-3-yl]propoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168740556 |
| Molecular Formula | C38H38N6O7 |
| Molecular Weight | 690.76 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | 4-[3-[1-[[4-[2-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]oxyethyl]phenyl]methyl]azetidin-3-yl]propoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Nc1nnc(-c2ccccc2O)cc1OCCc1ccc(CN2CC(CCCOc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)cc1 |
| InChI | InChI=1S/C38H38N6O7/c39-35-32(19-28(41-42-35)26-6-1-2-8-30(26)45)51-18-16-23-10-12-24(13-11-23)20-43-21-25(22-43)5-4-17-50-31-9-3-7-27-34(31)38(49)44(37(27)48)29-14-15-33(46)40-36(29)47/h1-3,6-13,19,25,29,45H,4-5,14-18,20-22H2,(H2,39,42)(H,40,46,47) |
| InChIKey | GDEOYOOIMMXQCB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 177.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.76 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|