C38H37N5O6 — CID 171503041
5-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide (PubChem CID 171503041) has the molecular formula C38H37N5O6 and a molecular weight of 659.74 g/mol. Its IUPAC name is 5-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide.
| Compound Name | 5-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 171503041 |
| Molecular Formula | C38H37N5O6 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.27 |
| IUPAC Name | 5-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
| SMILES | Cc1ccc(NC(=O)CCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1C(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C38H37N5O6/c1-22-16-17-25(21-29(22)35(46)40-23(2)26-12-7-10-24-9-3-4-11-27(24)26)41-32(44)15-5-6-20-39-30-14-8-13-28-34(30)38(49)43(37(28)48)31-18-19-33(45)42-36(31)47/h3-4,7-14,16-17,21,23,31,39H,5-6,15,18-20H2,1-2H3,(H,40,46)(H,41,44)(H,42,45,47)/t23-,31?/m1/s1 |
| InChIKey | QSBHIKNRZJRMTE-WNEYBHKTSA-N |
| XLogP | 5.26 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|