C35H32N6O6 — CID 171526112
5-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butanoylamino]-2-methyl-N-(quinolin-8-ylmethyl)benzamide (PubChem CID 171526112) has the molecular formula C35H32N6O6 and a molecular weight of 632.68 g/mol. Its IUPAC name is 5-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butanoylamino]-2-methyl-N-(quinolin-8-ylmethyl)benzamide.
| Compound Name | 5-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butanoylamino]-2-methyl-N-(quinolin-8-ylmethyl)benzamide |
|---|---|
| PubChem CID | 171526112 |
| Molecular Formula | C35H32N6O6 |
| Molecular Weight | 632.68 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | 5-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butanoylamino]-2-methyl-N-(quinolin-8-ylmethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)CCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1C(=O)NCc1cccc2cccnc12 |
| InChI | InChI=1S/C35H32N6O6/c1-20-12-13-23(18-25(20)32(44)38-19-22-7-2-6-21-8-4-17-37-31(21)22)39-28(42)11-5-16-36-26-10-3-9-24-30(26)35(47)41(34(24)46)27-14-15-29(43)40-33(27)45/h2-4,6-10,12-13,17-18,27,36H,5,11,14-16,19H2,1H3,(H,38,44)(H,39,42)(H,40,43,45) |
| InChIKey | ZDSFWAZSWQMEDL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 166.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|