C37H36N6O7 — CID 174225194
3-[(butanoylamino)-(8-hydroxy-5-methylquinolin-7-yl)methyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethyl]benzamide (PubChem CID 174225194) has the molecular formula C37H36N6O7 and a molecular weight of 676.73 g/mol. Its IUPAC name is 3-[(butanoylamino)-(8-hydroxy-5-methylquinolin-7-yl)methyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethyl]benzamide.
| Compound Name | 3-[(butanoylamino)-(8-hydroxy-5-methylquinolin-7-yl)methyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 174225194 |
| Molecular Formula | C37H36N6O7 |
| Molecular Weight | 676.73 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | 3-[(butanoylamino)-(8-hydroxy-5-methylquinolin-7-yl)methyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethyl]benzamide |
| SMILES | CCCC(=O)NC(c1cccc(C(=O)NCCNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)c1)c1cc(C)c2cccnc2c1O |
| InChI | InChI=1S/C37H36N6O7/c1-3-6-29(44)41-31(27-17-20(2)24-9-5-14-39-32(24)33(27)46)21-7-4-8-22(18-21)34(47)40-16-15-38-23-10-11-25-26(19-23)37(50)43(36(25)49)28-12-13-30(45)42-35(28)48/h4-5,7-11,14,17-19,28,31,38,46H,3,6,12-13,15-16H2,1-2H3,(H,40,47)(H,41,44)(H,42,45,48) |
| InChIKey | GCYBMGXNOWEZTO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 186.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|