C40H39ClN6O9 — CID 164865657
3-[(butanoylamino)-(5-chloro-8-hydroxyquinolin-7-yl)methyl]-N-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butyl]benzamide (PubChem CID 164865657) has the molecular formula C40H39ClN6O9 and a molecular weight of 783.24 g/mol. Its IUPAC name is 3-[(butanoylamino)-(5-chloro-8-hydroxyquinolin-7-yl)methyl]-N-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butyl]benzamide.
| Compound Name | 3-[(butanoylamino)-(5-chloro-8-hydroxyquinolin-7-yl)methyl]-N-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butyl]benzamide |
|---|---|
| PubChem CID | 164865657 |
| Molecular Formula | C40H39ClN6O9 |
| Molecular Weight | 783.24 g/mol |
| Exact Mass | 782.25 |
| IUPAC Name | 3-[(butanoylamino)-(5-chloro-8-hydroxyquinolin-7-yl)methyl]-N-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butyl]benzamide |
| SMILES | CCCC(=O)NC(c1cccc(C(=O)NCCCCNC(=O)COc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)c1)c1cc(Cl)c2cccnc2c1O |
| InChI | InChI=1S/C40H39ClN6O9/c1-2-8-30(48)45-34(26-20-27(41)24-12-7-18-43-35(24)36(26)51)22-9-5-10-23(19-22)37(52)44-17-4-3-16-42-32(50)21-56-29-13-6-11-25-33(29)40(55)47(39(25)54)28-14-15-31(49)46-38(28)53/h5-7,9-13,18-20,28,34,51H,2-4,8,14-17,21H2,1H3,(H,42,50)(H,44,52)(H,45,48)(H,46,49,53) |
| InChIKey | JHZGSUIWSKZFNK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 213.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|