C36H34ClN5O7 — CID 176877489
5-chloro-N-[6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]hexyl]-3-phenyl-1H-indole-2-carboxamide (PubChem CID 176877489) has the molecular formula C36H34ClN5O7 and a molecular weight of 684.15 g/mol. Its IUPAC name is 5-chloro-N-[6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]hexyl]-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]hexyl]-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 176877489 |
| Molecular Formula | C36H34ClN5O7 |
| Molecular Weight | 684.15 g/mol |
| Exact Mass | 683.21 |
| IUPAC Name | 5-chloro-N-[6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]hexyl]-3-phenyl-1H-indole-2-carboxamide |
| SMILES | O=C(COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)NCCCCCCNC(=O)c1[nH]c2ccc(Cl)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C36H34ClN5O7/c37-22-13-14-25-24(19-22)30(21-9-4-3-5-10-21)32(40-25)34(46)39-18-7-2-1-6-17-38-29(44)20-49-27-12-8-11-23-31(27)36(48)42(35(23)47)26-15-16-28(43)41-33(26)45/h3-5,8-14,19,26,40H,1-2,6-7,15-18,20H2,(H,38,44)(H,39,46)(H,41,43,45) |
| InChIKey | ZMFASYHIQDHONG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 166.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.15 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|