C40H42N6O7 — CID 156535636
N-(4-anilinoquinolin-6-yl)-10-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]decanamide (PubChem CID 156535636) has the molecular formula C40H42N6O7 and a molecular weight of 718.81 g/mol. Its IUPAC name is N-(4-anilinoquinolin-6-yl)-10-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]decanamide.
| Compound Name | N-(4-anilinoquinolin-6-yl)-10-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]decanamide |
|---|---|
| PubChem CID | 156535636 |
| Molecular Formula | C40H42N6O7 |
| Molecular Weight | 718.81 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | N-(4-anilinoquinolin-6-yl)-10-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]decanamide |
| SMILES | O=C(COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)NCCCCCCCCCC(=O)Nc1ccc2nccc(Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C40H42N6O7/c47-34(44-27-17-18-30-29(24-27)31(21-23-41-30)43-26-12-7-6-8-13-26)16-9-4-2-1-3-5-10-22-42-36(49)25-53-33-15-11-14-28-37(33)40(52)46(39(28)51)32-19-20-35(48)45-38(32)50/h6-8,11-15,17-18,21,23-24,32H,1-5,9-10,16,19-20,22,25H2,(H,41,43)(H,42,49)(H,44,47)(H,45,48,50) |
| InChIKey | DPMXPKFFZLLFGX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 175.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.81 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|