C42H44N6O8 — CID 159085325
4-anilino-6-[11-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-2-oxoundecyl]quinoline-3-carboxamide (PubChem CID 159085325) has the molecular formula C42H44N6O8 and a molecular weight of 760.85 g/mol. Its IUPAC name is 4-anilino-6-[11-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-2-oxoundecyl]quinoline-3-carboxamide.
| Compound Name | 4-anilino-6-[11-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-2-oxoundecyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 159085325 |
| Molecular Formula | C42H44N6O8 |
| Molecular Weight | 760.85 g/mol |
| Exact Mass | 760.32 |
| IUPAC Name | 4-anilino-6-[11-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-2-oxoundecyl]quinoline-3-carboxamide |
| SMILES | NC(=O)c1cnc2ccc(CC(=O)CCCCCCCCCNC(=O)COc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)cc2c1Nc1ccccc1 |
| InChI | InChI=1S/C42H44N6O8/c43-39(52)31-24-45-32-18-17-26(23-30(32)38(31)46-27-12-7-6-8-13-27)22-28(49)14-9-4-2-1-3-5-10-21-44-36(51)25-56-34-16-11-15-29-37(34)42(55)48(41(29)54)33-19-20-35(50)47-40(33)53/h6-8,11-13,15-18,23-24,33H,1-5,9-10,14,19-22,25H2,(H2,43,52)(H,44,51)(H,45,46)(H,47,50,53) |
| InChIKey | SXCRQABGXSPASZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 206.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|