C42H36N6O7 — CID 160724312
4-anilino-7-[4-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanoylamino]butanoyl]phenyl]quinoline-3-carboxamide (PubChem CID 160724312) has the molecular formula C42H36N6O7 and a molecular weight of 736.79 g/mol. Its IUPAC name is 4-anilino-7-[4-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanoylamino]butanoyl]phenyl]quinoline-3-carboxamide.
| Compound Name | 4-anilino-7-[4-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanoylamino]butanoyl]phenyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 160724312 |
| Molecular Formula | C42H36N6O7 |
| Molecular Weight | 736.79 g/mol |
| Exact Mass | 736.26 |
| IUPAC Name | 4-anilino-7-[4-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanoylamino]butanoyl]phenyl]quinoline-3-carboxamide |
| SMILES | NC(=O)c1cnc2cc(-c3ccc(C(=O)CCCNC(=O)CCc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)cc3)ccc2c1Nc1ccccc1 |
| InChI | InChI=1S/C42H36N6O7/c43-39(52)31-23-45-32-22-27(15-17-29(32)38(31)46-28-7-2-1-3-8-28)24-11-13-25(14-12-24)34(49)10-5-21-44-35(50)19-16-26-6-4-9-30-37(26)42(55)48(41(30)54)33-18-20-36(51)47-40(33)53/h1-4,6-9,11-15,17,22-23,33H,5,10,16,18-21H2,(H2,43,52)(H,44,50)(H,45,46)(H,47,51,53) |
| InChIKey | RGHUQNYKWDQULG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 197.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.79 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|