C44H44N8O7 — CID 169241702
4-anilino-6-[4-(4-formamidobutylcarbamoyl)phenyl]quinoline-3-carboxamide;2-(2,6-dioxopiperidin-3-yl)-4-[ethyl(methyl)amino]isoindole-1,3-dione (PubChem CID 169241702) has the molecular formula C44H44N8O7 and a molecular weight of 796.89 g/mol. Its IUPAC name is 4-anilino-6-[4-(4-formamidobutylcarbamoyl)phenyl]quinoline-3-carboxamide;2-(2,6-dioxopiperidin-3-yl)-4-[ethyl(methyl)amino]isoindole-1,3-dione.
| Compound Name | 4-anilino-6-[4-(4-formamidobutylcarbamoyl)phenyl]quinoline-3-carboxamide;2-(2,6-dioxopiperidin-3-yl)-4-[ethyl(methyl)amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 169241702 |
| Molecular Formula | C44H44N8O7 |
| Molecular Weight | 796.89 g/mol |
| Exact Mass | 796.33 |
| IUPAC Name | 4-anilino-6-[4-(4-formamidobutylcarbamoyl)phenyl]quinoline-3-carboxamide;2-(2,6-dioxopiperidin-3-yl)-4-[ethyl(methyl)amino]isoindole-1,3-dione |
| SMILES | CCN(C)c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.NC(=O)c1cnc2ccc(-c3ccc(C(=O)NCCCCNC=O)cc3)cc2c1Nc1ccccc1 |
| InChI | InChI=1S/C28H27N5O3.C16H17N3O4/c29-27(35)24-17-32-25-13-12-21(16-23(25)26(24)33-22-6-2-1-3-7-22)19-8-10-20(11-9-19)28(36)31-15-5-4-14-30-18-34;1-3-18(2)10-6-4-5-9-13(10)16(23)19(15(9)22)11-7-8-12(20)17-14(11)21/h1-3,6-13,16-18H,4-5,14-15H2,(H2,29,35)(H,30,34)(H,31,36)(H,32,33);4-6,11H,3,7-8H2,1-2H3,(H,17,20,21) |
| InChIKey | HZLJJAJXPPUSBE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 213.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.89 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|